CAS 379726-20-2 appears in our catalog under these names: 2-(4-Phenylphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid, 95%, 2-([1,1'-Biphenyl]-4-yl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
(Z)-2-(4-phenylphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid (CAS 379726-20-2) is a chemical compound with the molecular formula C24H22O5 and a molecular weight of 390.4 g/mol. IUPAC name: (Z)-2-(4-phenylphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid. InChIKey: BGBZINXZBCPRCI-MOSHPQCFSA-N.
| Molecular formula | C24H22O5 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | (Z)-2-(4-phenylphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| InChIKey | BGBZINXZBCPRCI-MOSHPQCFSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=C(/C2=CC=C(C=C2)C3=CC=CC=C3)\C(=O)O |
Computed by PubChem (NCBI)