CAS 882427-71-6 is the registry number for 2,2-Dimethyl-5,7-bis(phenylmethoxy)-4H-1,3-benzodioxin-4-one. Offered by: TRC. Available pack sizes: 100mg.
2,2-dimethyl-5,7-bis(phenylmethoxy)-1,3-benzodioxin-4-one (CAS 882427-71-6) is a chemical compound with the molecular formula C24H22O5 and a molecular weight of 390.4 g/mol. IUPAC name: 2,2-dimethyl-5,7-bis(phenylmethoxy)-1,3-benzodioxin-4-one. InChIKey: SZJULAPTZSLDJN-UHFFFAOYSA-N.
| Molecular formula | C24H22O5 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 2,2-dimethyl-5,7-bis(phenylmethoxy)-1,3-benzodioxin-4-one |
| InChIKey | SZJULAPTZSLDJN-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(C(=CC(=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)C(=O)O1)C |
Computed by PubChem (NCBI)