Products 2351225-46-0
CAS 2351225-46-0 is the registry number for NSD-IN-2, 98.16%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 5 mg, 10mM/1mL, 10 mg, 1 mg.
2-amino-6-(2-methylaziridin-1-yl)-1,3-benzothiazol-4-ol (CAS 2351225-46-0) is a chemical compound with the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. IUPAC name: 2-amino-6-(2-methylaziridin-1-yl)-1,3-benzothiazol-4-ol. InChIKey: PHBIAWCGMOCBGF-UHFFFAOYSA-N.
| Molecular formula | C10H11N3OS |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | 2-amino-6-(2-methylaziridin-1-yl)-1,3-benzothiazol-4-ol |
| InChIKey | PHBIAWCGMOCBGF-UHFFFAOYSA-N |
| SMILES | CC1CN1C2=CC(=C3C(=C2)SC(=N3)N)O |
Computed by PubChem (NCBI)