CAS 23516-79-2 appears in our catalog under these names: 4-Trifluoroacetylaniline, 1–(4–Aminophenyl)–2,2,2–trifluoro–1–ethanone, 1-(4-Aminophenyl)-2,2,2-trifluoroethanone 95%, 1-(4-Aminophenyl)-2,2,2-trifluoroethanone, 95%, 95%, 1-(4-Aminophenyl)-2,2,2-trifluoroethanone, 97%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 1g, 250mg, 5g.
1-(4-aminophenyl)-2,2,2-trifluoroethanone (CAS 23516-79-2) is a chemical compound with the molecular formula C8H6F3NO and a molecular weight of 189.13 g/mol. IUPAC name: 1-(4-aminophenyl)-2,2,2-trifluoroethanone. InChIKey: GHGLSQSKVJUUNZ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO |
|---|---|
| Molecular weight | 189.13 g/mol |
| IUPAC name | 1-(4-aminophenyl)-2,2,2-trifluoroethanone |
| InChIKey | GHGLSQSKVJUUNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)