CAS 23516-80-5 appears in our catalog under these names: 1-(3-Aminophenyl)-2,2,2-trifluoroethan-1-one, 1-(3-Aminophenyl)-2,2,2-trifluoroethan-1-one 95%, 1-(3-Aminophenyl)-2,2,2-trifluoroethan-1-one, 95%, 95%, 1-(3-Aminophenyl)-2,2,2-trifluoroethan-1-one, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g.
1-(3-aminophenyl)-2,2,2-trifluoroethanone (CAS 23516-80-5) is a chemical compound with the molecular formula C8H6F3NO and a molecular weight of 189.13 g/mol. IUPAC name: 1-(3-aminophenyl)-2,2,2-trifluoroethanone. InChIKey: VWZINROLVVODOZ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO |
|---|---|
| Molecular weight | 189.13 g/mol |
| IUPAC name | 1-(3-aminophenyl)-2,2,2-trifluoroethanone |
| InChIKey | VWZINROLVVODOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)