Products 2351621-48-0
CAS 2351621-48-0 is the registry number for (2S)-2-((tert-Butoxycarbonyl)amino)-2-(3,3-dimethylcyclohexyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(3,3-dimethylcyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 2351621-48-0) is a chemical compound with the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. IUPAC name: (2S)-2-(3,3-dimethylcyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: YOHRIRGCORBUCT-DTIOYNMSSA-N.
| Molecular formula | C15H27NO4 |
|---|---|
| Molecular weight | 285.38 g/mol |
| IUPAC name | (2S)-2-(3,3-dimethylcyclohexyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | YOHRIRGCORBUCT-DTIOYNMSSA-N |
| SMILES | CC1(CCCC(C1)[C@@H](C(=O)O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)