Products 2351883-15-1
CAS 2351883-15-1 is the registry number for Antibiotic adjuvant 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-chloroanilino)-8-hydroxynaphthalene-1,4-dione (CAS 2351883-15-1) is a chemical compound with the molecular formula C16H10ClNO3 and a molecular weight of 299.71 g/mol. IUPAC name: 2-(4-chloroanilino)-8-hydroxynaphthalene-1,4-dione. InChIKey: IPILTZKHIYSVBC-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO3 |
|---|---|
| Molecular weight | 299.71 g/mol |
| IUPAC name | 2-(4-chloroanilino)-8-hydroxynaphthalene-1,4-dione |
| InChIKey | IPILTZKHIYSVBC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C(=CC2=O)NC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)
Synonyms:
Antibiotic adjuvant 1, orb2664099