Products 2352624-72-5
CAS 2352624-72-5 is the registry number for 1-(2,6-Dibromophenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-(2,6-dibromophenyl)-2,2-difluoroethanone (CAS 2352624-72-5) is a chemical compound with the molecular formula C8H4Br2F2O and a molecular weight of 313.92 g/mol. IUPAC name: 1-(2,6-dibromophenyl)-2,2-difluoroethanone. InChIKey: XDUSZBGYDHDEDP-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F2O |
|---|---|
| Molecular weight | 313.92 g/mol |
| IUPAC name | 1-(2,6-dibromophenyl)-2,2-difluoroethanone |
| InChIKey | XDUSZBGYDHDEDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(=O)C(F)F)Br |
Computed by PubChem (NCBI)