Products 2352913-90-5
CAS 2352913-90-5 is the registry number for 2-Bromo-2-(4-chloro-3-fluorophenyl)ethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-2-(4-chloro-3-fluorophenyl)ethanol (CAS 2352913-90-5) is a chemical compound with the molecular formula C8H7BrClFO and a molecular weight of 253.49 g/mol. IUPAC name: 2-bromo-2-(4-chloro-3-fluorophenyl)ethanol. InChIKey: ILMVQVPUFVCCES-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClFO |
|---|---|
| Molecular weight | 253.49 g/mol |
| IUPAC name | 2-bromo-2-(4-chloro-3-fluorophenyl)ethanol |
| InChIKey | ILMVQVPUFVCCES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CO)Br)F)Cl |
Computed by PubChem (NCBI)