Products 2353039-79-7
CAS 2353039-79-7 is the registry number for 1-(3,4-dibromophenyl)-2,2-difluoro-ethanone, 97%. Offered by: Chemat. Available pack sizes: 1g.
1-(3,4-dibromophenyl)-2,2-difluoroethanone (CAS 2353039-79-7) is a chemical compound with the molecular formula C8H4Br2F2O and a molecular weight of 313.92 g/mol. IUPAC name: 1-(3,4-dibromophenyl)-2,2-difluoroethanone. InChIKey: DHLQKOCQZPZHOQ-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F2O |
|---|---|
| Molecular weight | 313.92 g/mol |
| IUPAC name | 1-(3,4-dibromophenyl)-2,2-difluoroethanone |
| InChIKey | DHLQKOCQZPZHOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)F)Br)Br |
Computed by PubChem (NCBI)