CAS 2353202-15-8 is the registry number for Methyl 4-(1-aminocyclopropyl)-3-methylbenzoate, 97%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg.
Methyl 4-(1-aminocyclopropyl)-3-methylbenzoate (CAS 2353202-15-8) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: methyl 4-(1-aminocyclopropyl)-3-methylbenzoate. InChIKey: GOTMENCVLABXMG-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | methyl 4-(1-aminocyclopropyl)-3-methylbenzoate |
| InChIKey | GOTMENCVLABXMG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OC)C2(CC2)N |
Computed by PubChem (NCBI)