Products 2353621-86-8
CAS 2353621-86-8 is the registry number for 1-(5-Bromo-2-chloro-3-pyridinyl)-1-propanone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(5-bromo-2-chloro-3-pyridinyl)propan-1-one (CAS 2353621-86-8) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 1-(5-bromo-2-chloro-3-pyridinyl)propan-1-one. InChIKey: LMAOANIPKMYXTB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 1-(5-bromo-2-chloro-3-pyridinyl)propan-1-one |
| InChIKey | LMAOANIPKMYXTB-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(N=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)