Products 2353657-61-9
CAS 2353657-61-9 is the registry number for (3-Methyl-5-nitrophenyl)methanesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-methyl-5-nitrophenyl)methanesulfonyl chloride (CAS 2353657-61-9) is a chemical compound with the molecular formula C8H8ClNO4S and a molecular weight of 249.67 g/mol. IUPAC name: (3-methyl-5-nitrophenyl)methanesulfonyl chloride. InChIKey: UVZQQFYLNARXMJ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4S |
|---|---|
| Molecular weight | 249.67 g/mol |
| IUPAC name | (3-methyl-5-nitrophenyl)methanesulfonyl chloride |
| InChIKey | UVZQQFYLNARXMJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)[N+](=O)[O-])CS(=O)(=O)Cl |
Computed by PubChem (NCBI)