Products 2353722-99-1

CAS 2353722-99-1 appears in our catalog under these names: 4-Bromo-2,6-dimethoxybenzenesulfonyl chloride, 95%, 95%, 4-Bromo-2,6-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

4-bromo-2,6-dimethoxybenzenesulfonyl chloride (CAS 2353722-99-1) is a chemical compound with the molecular formula C8H8BrClO4S and a molecular weight of 315.57 g/mol. IUPAC name: 4-bromo-2,6-dimethoxybenzenesulfonyl chloride. InChIKey: VFGKYMFMCXXPTP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrClO4S
Molecular weight315.57 g/mol
IUPAC name4-bromo-2,6-dimethoxybenzenesulfonyl chloride
InChIKeyVFGKYMFMCXXPTP-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1S(=O)(=O)Cl)OC)Br

Computed by PubChem (NCBI)