Products 51072-64-1

CAS 51072-64-1 is the registry number for 2-Bromo-4,5-dimethoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-bromo-4,5-dimethoxybenzenesulfonyl chloride (CAS 51072-64-1) is a chemical compound with the molecular formula C8H8BrClO4S and a molecular weight of 315.57 g/mol. IUPAC name: 2-bromo-4,5-dimethoxybenzenesulfonyl chloride. InChIKey: UGBLMSQDINTCMI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrClO4S
Molecular weight315.57 g/mol
IUPAC name2-bromo-4,5-dimethoxybenzenesulfonyl chloride
InChIKeyUGBLMSQDINTCMI-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1OC)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)