CAS 51072-64-1 is the registry number for 2-Bromo-4,5-dimethoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-bromo-4,5-dimethoxybenzenesulfonyl chloride (CAS 51072-64-1) is a chemical compound with the molecular formula C8H8BrClO4S and a molecular weight of 315.57 g/mol. IUPAC name: 2-bromo-4,5-dimethoxybenzenesulfonyl chloride. InChIKey: UGBLMSQDINTCMI-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO4S |
|---|---|
| Molecular weight | 315.57 g/mol |
| IUPAC name | 2-bromo-4,5-dimethoxybenzenesulfonyl chloride |
| InChIKey | UGBLMSQDINTCMI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1OC)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)