CAS 85477-02-7 is the registry number for 5-Bromo-2,4-dimethoxybenzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-bromo-2,4-dimethoxybenzenesulfonyl chloride (CAS 85477-02-7) is a chemical compound with the molecular formula C8H8BrClO4S and a molecular weight of 315.57 g/mol. IUPAC name: 5-bromo-2,4-dimethoxybenzenesulfonyl chloride. InChIKey: AHQXIQGOFUWTAS-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO4S |
|---|---|
| Molecular weight | 315.57 g/mol |
| IUPAC name | 5-bromo-2,4-dimethoxybenzenesulfonyl chloride |
| InChIKey | AHQXIQGOFUWTAS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1S(=O)(=O)Cl)Br)OC |
Computed by PubChem (NCBI)