Products 2354059-42-8
CAS 2354059-42-8 is the registry number for 2-(2-Chloro-6-methylpyrimidin-4-yl)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chloro-6-methylpyrimidin-4-yl)propan-2-ol (CAS 2354059-42-8) is a chemical compound with the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. IUPAC name: 2-(2-chloro-6-methylpyrimidin-4-yl)propan-2-ol. InChIKey: JYXXWZHLPMXRSX-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O |
|---|---|
| Molecular weight | 186.64 g/mol |
| IUPAC name | 2-(2-chloro-6-methylpyrimidin-4-yl)propan-2-ol |
| InChIKey | JYXXWZHLPMXRSX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)Cl)C(C)(C)O |
Computed by PubChem (NCBI)