CAS 70849-27-3 appears in our catalog under these names: D-Altrose-1-13C, 98% 98%atom%13C, D-Altrose-1-13C, >95% (HPLC), D-Altrose-1-13C. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 100 mg, 10 mg.
(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy(113C)hexanal (CAS 70849-27-3) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy(113C)hexanal. InChIKey: GZCGUPFRVQAUEE-IKGLOVJPSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy(113C)hexanal |
| InChIKey | GZCGUPFRVQAUEE-IKGLOVJPSA-N |
| SMILES | C([C@H]([C@H]([C@H]([C@@H]([13CH]=O)O)O)O)O)O |
Computed by PubChem (NCBI)