CAS 2357110-72-4 is the registry number for CRBN ligand-300. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(7-bromo-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione (CAS 2357110-72-4) is a chemical compound with the molecular formula C12H9BrN2O4 and a molecular weight of 325.11 g/mol. IUPAC name: 3-(7-bromo-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione. InChIKey: SKXUZUZFBLHEFM-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O4 |
|---|---|
| Molecular weight | 325.11 g/mol |
| IUPAC name | 3-(7-bromo-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
| InChIKey | SKXUZUZFBLHEFM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C3=C(C(=CC=C3)Br)OC2=O |
Computed by PubChem (NCBI)