CAS 2357114-20-4 appears in our catalog under these names: 3-(6-Bromo-2-oxobenzo[d]oxazol-3(2H)-yl)piperidine-2,6-dione, 98%, 98%, 3-(6-Bromo-2-oxobenzo[d]oxazol-3(2H)-yl)piperidine-2,6-dione, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione (CAS 2357114-20-4) is a chemical compound with the molecular formula C12H9BrN2O4 and a molecular weight of 325.11 g/mol. IUPAC name: 3-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione. InChIKey: ASPBNCYMQGKLBA-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O4 |
|---|---|
| Molecular weight | 325.11 g/mol |
| IUPAC name | 3-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
| InChIKey | ASPBNCYMQGKLBA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C3=C(C=C(C=C3)Br)OC2=O |
Computed by PubChem (NCBI)