Products 3076713-30-6
CAS 3076713-30-6 is the registry number for 3-(5-bromo-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
3-(5-bromo-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione (CAS 3076713-30-6) is a chemical compound with the molecular formula C12H9BrN2O4 and a molecular weight of 325.11 g/mol. IUPAC name: 3-(5-bromo-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione. InChIKey: XEZQZYJUHNCFHI-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O4 |
|---|---|
| Molecular weight | 325.11 g/mol |
| IUPAC name | 3-(5-bromo-2-oxo-1,3-benzoxazol-3-yl)piperidine-2,6-dione |
| InChIKey | XEZQZYJUHNCFHI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C3=C(C=CC(=C3)Br)OC2=O |
Computed by PubChem (NCBI)