Products 2361420-45-1
CAS 2361420-45-1 appears in our catalog under these names: (4-(1-Cyclopropylpiperidin-4-yl)phenyl)boronic acid, 98%, (4-(1-Cyclopropylpiperidin-4-yl)phenyl)boronic acid, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg.
[4-(1-cyclopropylpiperidin-4-yl)phenyl]boronic acid (CAS 2361420-45-1) is a chemical compound with the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. IUPAC name: [4-(1-cyclopropylpiperidin-4-yl)phenyl]boronic acid. InChIKey: FIGUDBJODMGTPJ-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO2 |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | [4-(1-cyclopropylpiperidin-4-yl)phenyl]boronic acid |
| InChIKey | FIGUDBJODMGTPJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2CCN(CC2)C3CC3)(O)O |
Computed by PubChem (NCBI)