Products 2661398-11-2
CAS 2661398-11-2 is the registry number for (E)-2-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)vinyl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]aniline (CAS 2661398-11-2) is a chemical compound with the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. IUPAC name: 2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]aniline. InChIKey: GAUAWNZRRUJYJW-MDZDMXLPSA-N.
| Molecular formula | C14H20BNO2 |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | 2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]aniline |
| InChIKey | GAUAWNZRRUJYJW-MDZDMXLPSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC=CC=C2N |
Computed by PubChem (NCBI)