Products 2361497-72-3
CAS 2361497-72-3 is the registry number for CPL207280, 98.72%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 5 mg, 10 mg, 25 mg.
(3S)-3-[4-(2,3-dimethylbut-2-enoxy)phenyl]hex-4-ynoic acid (CAS 2361497-72-3) is a chemical compound with the molecular formula C18H22O3 and a molecular weight of 286.4 g/mol. IUPAC name: (3S)-3-[4-(2,3-dimethylbut-2-enoxy)phenyl]hex-4-ynoic acid. InChIKey: PZCCCBKQGSMWLD-INIZCTEOSA-N.
| Molecular formula | C18H22O3 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (3S)-3-[4-(2,3-dimethylbut-2-enoxy)phenyl]hex-4-ynoic acid |
| InChIKey | PZCCCBKQGSMWLD-INIZCTEOSA-N |
| SMILES | CC#C[C@@H](CC(=O)O)C1=CC=C(C=C1)OCC(=C(C)C)C |
Computed by PubChem (NCBI)