CAS 2361634-08-2 is the registry number for 1H,3H-Furo(3,4-b)quinolin-9-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,3-dihydrofuro[3,4-b]quinolin-9-amine (CAS 2361634-08-2) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 1,3-dihydrofuro[3,4-b]quinolin-9-amine. InChIKey: LHTPJTGQDNDXSL-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 1,3-dihydrofuro[3,4-b]quinolin-9-amine |
| InChIKey | LHTPJTGQDNDXSL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=CC=CC=C3N=C2CO1)N |
Computed by PubChem (NCBI)