CAS 2361635-82-5 is the registry number for 4-(Dimethylphosphoryl)-2-nitroaniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-dimethylphosphoryl-2-nitroaniline (CAS 2361635-82-5) is a chemical compound with the molecular formula C8H11N2O3P and a molecular weight of 214.16 g/mol. IUPAC name: 4-dimethylphosphoryl-2-nitroaniline. InChIKey: VDWHHDSTRVJNJW-UHFFFAOYSA-N.
| Molecular formula | C8H11N2O3P |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | 4-dimethylphosphoryl-2-nitroaniline |
| InChIKey | VDWHHDSTRVJNJW-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)