Products 2796343-04-7
CAS 2796343-04-7 is the registry number for BT-114143. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylphosphonic acid (CAS 2796343-04-7) is a chemical compound with the molecular formula C8H11N2O3P and a molecular weight of 214.16 g/mol. IUPAC name: 5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylphosphonic acid. InChIKey: GHUHTYRORYYPJJ-UHFFFAOYSA-N.
| Molecular formula | C8H11N2O3P |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-1,6-naphthyridin-2-ylphosphonic acid |
| InChIKey | GHUHTYRORYYPJJ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1N=C(C=C2)P(=O)(O)O |
Computed by PubChem (NCBI)