CAS 2624136-36-1 is the registry number for Methyl 5-(dimethylphosphoryl)pyrimidine-2-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-dimethylphosphorylpyrimidine-2-carboxylate (CAS 2624136-36-1) is a chemical compound with the molecular formula C8H11N2O3P and a molecular weight of 214.16 g/mol. IUPAC name: methyl 5-dimethylphosphorylpyrimidine-2-carboxylate. InChIKey: MDVKCNAVQUCHKK-UHFFFAOYSA-N.
| Molecular formula | C8H11N2O3P |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | methyl 5-dimethylphosphorylpyrimidine-2-carboxylate |
| InChIKey | MDVKCNAVQUCHKK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C=N1)P(=O)(C)C |
Computed by PubChem (NCBI)