CAS 2361732-31-0 is the registry number for 2-Chloro-3,4-dimethoxyaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-3,4-dimethoxyaniline;hydrochloride (CAS 2361732-31-0) is a chemical compound with the molecular formula C8H11Cl2NO2 and a molecular weight of 224.08 g/mol. IUPAC name: 2-chloro-3,4-dimethoxyaniline;hydrochloride. InChIKey: QMPWIASHHCDRFP-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2NO2 |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | 2-chloro-3,4-dimethoxyaniline;hydrochloride |
| InChIKey | QMPWIASHHCDRFP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)N)Cl)OC.Cl |
Computed by PubChem (NCBI)