Products 2361963-14-4

CAS 2361963-14-4 is the registry number for 5-(Dimethylphosphoryl)nicotinic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-dimethylphosphorylpyridine-3-carboxylic acid (CAS 2361963-14-4) is a chemical compound with the molecular formula C8H10NO3P and a molecular weight of 199.14 g/mol. IUPAC name: 5-dimethylphosphorylpyridine-3-carboxylic acid. InChIKey: IWQZCFUDCQKEGV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10NO3P
Molecular weight199.14 g/mol
IUPAC name5-dimethylphosphorylpyridine-3-carboxylic acid
InChIKeyIWQZCFUDCQKEGV-UHFFFAOYSA-N
SMILESCP(=O)(C)C1=CN=CC(=C1)C(=O)O

Computed by PubChem (NCBI)