Products 2362010-59-9
CAS 2362010-59-9 appears in our catalog under these names: 4-(Dimethylphosphoryl)picolinic acid 95%, 4-(Dimethylphosphoryl)picolinic acid, 95%, 95%, 4-(Dimethylphosphoryl)picolinic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-dimethylphosphorylpyridine-2-carboxylic acid (CAS 2362010-59-9) is a chemical compound with the molecular formula C8H10NO3P and a molecular weight of 199.14 g/mol. IUPAC name: 4-dimethylphosphorylpyridine-2-carboxylic acid. InChIKey: DJZWXUQYXOEPOL-UHFFFAOYSA-N.
| Molecular formula | C8H10NO3P |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 4-dimethylphosphorylpyridine-2-carboxylic acid |
| InChIKey | DJZWXUQYXOEPOL-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC(=NC=C1)C(=O)O |
Computed by PubChem (NCBI)