CAS 26786-59-4 is the registry number for Dimethyl(3-nitrophenyl)phosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-dimethylphosphoryl-3-nitrobenzene (CAS 26786-59-4) is a chemical compound with the molecular formula C8H10NO3P and a molecular weight of 199.14 g/mol. IUPAC name: 1-dimethylphosphoryl-3-nitrobenzene. InChIKey: AEOIRUGFEFHTSK-UHFFFAOYSA-N.
| Molecular formula | C8H10NO3P |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 1-dimethylphosphoryl-3-nitrobenzene |
| InChIKey | AEOIRUGFEFHTSK-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)