Products 2363154-96-3
CAS 2363154-96-3 is the registry number for Methyl 2-fluoro-6-methoxy-4-methylbenzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-fluoro-6-methoxy-4-methylbenzoate (CAS 2363154-96-3) is a chemical compound with the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. IUPAC name: methyl 2-fluoro-6-methoxy-4-methylbenzoate. InChIKey: PQAHHOJQBFPBJP-UHFFFAOYSA-N.
| Molecular formula | C10H11FO3 |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | methyl 2-fluoro-6-methoxy-4-methylbenzoate |
| InChIKey | PQAHHOJQBFPBJP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)F)C(=O)OC)OC |
Computed by PubChem (NCBI)