Products 2363171-32-6
CAS 2363171-32-6 is the registry number for N-(2-Chloro-5-nitrophenyl)-5-methyl-3-oxohexanamide, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg.
N-(2-chloro-5-nitrophenyl)-5-methyl-3-oxohexanamide (CAS 2363171-32-6) is a chemical compound with the molecular formula C13H15ClN2O4 and a molecular weight of 298.72 g/mol. IUPAC name: N-(2-chloro-5-nitrophenyl)-5-methyl-3-oxohexanamide. InChIKey: MPGRYWAAQBVOBF-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O4 |
|---|---|
| Molecular weight | 298.72 g/mol |
| IUPAC name | N-(2-chloro-5-nitrophenyl)-5-methyl-3-oxohexanamide |
| InChIKey | MPGRYWAAQBVOBF-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)CC(=O)NC1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)