Products 2737202-66-1
CAS 2737202-66-1 is the registry number for H-L-Phe(4-NH-Poc)-OH (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-3-[4-(prop-2-ynoxycarbonylamino)phenyl]propanoic acid;hydrochloride (CAS 2737202-66-1) is a chemical compound with the molecular formula C13H15ClN2O4 and a molecular weight of 298.72 g/mol. IUPAC name: (2S)-2-amino-3-[4-(prop-2-ynoxycarbonylamino)phenyl]propanoic acid;hydrochloride. InChIKey: PKNZLMSSIPKCPT-MERQFXBCSA-N.
| Molecular formula | C13H15ClN2O4 |
|---|---|
| Molecular weight | 298.72 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(prop-2-ynoxycarbonylamino)phenyl]propanoic acid;hydrochloride |
| InChIKey | PKNZLMSSIPKCPT-MERQFXBCSA-N |
| SMILES | C#CCOC(=O)NC1=CC=C(C=C1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)