Products 2364584-77-8
CAS 2364584-77-8 is the registry number for 5-(3,5-Bis(trifluoromethyl)phenyl)oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
5-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazole (CAS 2364584-77-8) is a chemical compound with the molecular formula C11H5F6NO and a molecular weight of 281.15 g/mol. IUPAC name: 5-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazole. InChIKey: HMUBFNHKBYSSDC-UHFFFAOYSA-N.
| Molecular formula | C11H5F6NO |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 5-[3,5-bis(trifluoromethyl)phenyl]-1,3-oxazole |
| InChIKey | HMUBFNHKBYSSDC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C2=CN=CO2 |
Computed by PubChem (NCBI)