CAS 949507-83-9 appears in our catalog under these names: 2,8-Bis(trifluoromethyl)quinolin-4(1H)-one 98%, 2,8-Bis(trifluoromethyl)quinolin-4(1H)-one, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 500g, 1g, 5g, 25g, 100g.
2,8-bis(trifluoromethyl)-1H-quinolin-4-one (CAS 949507-83-9) is a chemical compound with the molecular formula C11H5F6NO and a molecular weight of 281.15 g/mol. IUPAC name: 2,8-bis(trifluoromethyl)-1H-quinolin-4-one. InChIKey: JIWHKBAFGFPZKM-UHFFFAOYSA-N.
| Molecular formula | C11H5F6NO |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 2,8-bis(trifluoromethyl)-1H-quinolin-4-one |
| InChIKey | JIWHKBAFGFPZKM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(F)(F)F)NC(=CC2=O)C(F)(F)F |
Computed by PubChem (NCBI)