CAS 237076-72-1 appears in our catalog under these names: 5,7-Bis(trifluoromethyl)-4-hydroxyquinoline, 95%, 5,7-Bis(trifluoromethyl)quinolin-4(1H)-one, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
5,7-bis(trifluoromethyl)-1H-quinolin-4-one (CAS 237076-72-1) is a chemical compound with the molecular formula C11H5F6NO and a molecular weight of 281.15 g/mol. IUPAC name: 5,7-bis(trifluoromethyl)-1H-quinolin-4-one. InChIKey: VMUHDGVEVRDEMW-UHFFFAOYSA-N.
| Molecular formula | C11H5F6NO |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 5,7-bis(trifluoromethyl)-1H-quinolin-4-one |
| InChIKey | VMUHDGVEVRDEMW-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=CC(=C2C1=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)