CAS 2365173-89-1 is the registry number for Ethyl 3-((4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)cyclopentane-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g, 10g.
Ethyl 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]cyclopentane-1-carboxylate (CAS 2365173-89-1) is a chemical compound with the molecular formula C15H27BO4 and a molecular weight of 282.19 g/mol. IUPAC name: ethyl 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]cyclopentane-1-carboxylate. InChIKey: NDYHGNUPQSVNEW-UHFFFAOYSA-N.
| Molecular formula | C15H27BO4 |
|---|---|
| Molecular weight | 282.19 g/mol |
| IUPAC name | ethyl 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]cyclopentane-1-carboxylate |
| InChIKey | NDYHGNUPQSVNEW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CCC(C2)C(=O)OCC |
Computed by PubChem (NCBI)