CAS 620634-97-1 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-yl pivalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl] 2,2-dimethylpropanoate (CAS 620634-97-1) is a chemical compound with the molecular formula C15H27BO4 and a molecular weight of 282.19 g/mol. IUPAC name: [(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl] 2,2-dimethylpropanoate. InChIKey: GIWZPHIHXFZSSH-CSKARUKUSA-N.
| Molecular formula | C15H27BO4 |
|---|---|
| Molecular weight | 282.19 g/mol |
| IUPAC name | [(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl] 2,2-dimethylpropanoate |
| InChIKey | GIWZPHIHXFZSSH-CSKARUKUSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCOC(=O)C(C)(C)C |
Computed by PubChem (NCBI)