CAS 791845-41-5 is the registry number for (Z)-6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-en-1-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(Z)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-enyl] acetate (CAS 791845-41-5) is a chemical compound with the molecular formula C15H27BO4 and a molecular weight of 282.19 g/mol. IUPAC name: [(Z)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-enyl] acetate. InChIKey: UIJWBPCIPCNWRR-ZRDIBKRKSA-N.
| Molecular formula | C15H27BO4 |
|---|---|
| Molecular weight | 282.19 g/mol |
| IUPAC name | [(Z)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-enyl] acetate |
| InChIKey | UIJWBPCIPCNWRR-ZRDIBKRKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C(=C/CCCCOC(=O)C)/C |
Computed by PubChem (NCBI)