Products 2365471-17-4
CAS 2365471-17-4 is the registry number for UR–144 N–(4–chloropentyl) analog. Offered by: GLPBio. Available pack sizes: 1mg, 100μg, 500μg.
[1-(4-chloropentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (CAS 2365471-17-4) is a chemical compound with the molecular formula C21H28ClNO and a molecular weight of 345.9 g/mol. IUPAC name: [1-(4-chloropentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone. InChIKey: UOFHQAJWQKZFDB-UHFFFAOYSA-N.
| Molecular formula | C21H28ClNO |
|---|---|
| Molecular weight | 345.9 g/mol |
| IUPAC name | [1-(4-chloropentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| InChIKey | UOFHQAJWQKZFDB-UHFFFAOYSA-N |
| SMILES | CC(CCCN1C=C(C2=CC=CC=C21)C(=O)C3C(C3(C)C)(C)C)Cl |
Computed by PubChem (NCBI)