CAS 2366222-05-9 appears in our catalog under these names: SK1–I hydrochloride, SK1-I HCl 98%, (2R,3S,E)-2-(Methylamino)-5-(4-pentylphenyl)pent-4-ene-1,3-diol hydrochloride, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg.
(E,2R,3S)-2-(methylamino)-5-(4-pentylphenyl)pent-4-ene-1,3-diol;hydrochloride (CAS 2366222-05-9) is a chemical compound with the molecular formula C17H28ClNO2 and a molecular weight of 313.9 g/mol. IUPAC name: (E,2R,3S)-2-(methylamino)-5-(4-pentylphenyl)pent-4-ene-1,3-diol;hydrochloride. InChIKey: SGCJOKUPGVFNKS-UUCPMUBFSA-N.
| Molecular formula | C17H28ClNO2 |
|---|---|
| Molecular weight | 313.9 g/mol |
| IUPAC name | (E,2R,3S)-2-(methylamino)-5-(4-pentylphenyl)pent-4-ene-1,3-diol;hydrochloride |
| InChIKey | SGCJOKUPGVFNKS-UUCPMUBFSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)/C=C/[C@@H]([C@@H](CO)NC)O.Cl |
Computed by PubChem (NCBI)