CAS 99300-78-4 appears in our catalog under these names: Venlafaxine Hydrochloride, Venlafaxine Hydrochloride, >98.0%(HPLC)(T), Venlafaxine (hydrochloride), 99.76%, Venlafaxine (hydrochloride) (Standard), 99.99%, Venlafaxine hydrochloride, Concentration: 100 µg/ml Solvent: Methanol. Offered by: ZABRONIONE, TCI, MedChemExpress, HPC Standards. Available pack sizes: All package sizes, 1g, 5g, 10 mg, 5 mg, 10mM/1mL, 50 mg, 100 mg.
1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride (CAS 99300-78-4) is a chemical compound with the molecular formula C17H28ClNO2 and a molecular weight of 313.9 g/mol. IUPAC name: 1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride. InChIKey: QYRYFNHXARDNFZ-UHFFFAOYSA-N.
| Molecular formula | C17H28ClNO2 |
|---|---|
| Molecular weight | 313.9 g/mol |
| IUPAC name | 1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol;hydrochloride |
| InChIKey | QYRYFNHXARDNFZ-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C1=CC=C(C=C1)OC)C2(CCCCC2)O.Cl |
Computed by PubChem (NCBI)