Products 72795-04-1
CAS 72795-04-1 is the registry number for threo-ICI 118551 Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
(2R,3S)-1-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-(propan-2-ylamino)butan-2-ol;hydrochloride (CAS 72795-04-1) is a chemical compound with the molecular formula C17H28ClNO2 and a molecular weight of 313.9 g/mol. IUPAC name: (2R,3S)-1-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-(propan-2-ylamino)butan-2-ol;hydrochloride. InChIKey: KBXMBGWSOLBOQM-LINSIKMZSA-N.
| Molecular formula | C17H28ClNO2 |
|---|---|
| Molecular weight | 313.9 g/mol |
| IUPAC name | (2R,3S)-1-[(7-methyl-2,3-dihydro-1H-inden-4-yl)oxy]-3-(propan-2-ylamino)butan-2-ol;hydrochloride |
| InChIKey | KBXMBGWSOLBOQM-LINSIKMZSA-N |
| SMILES | CC1=C2CCCC2=C(C=C1)OC[C@@H]([C@H](C)NC(C)C)O.Cl |
Computed by PubChem (NCBI)