Products 2368910-19-2
CAS 2368910-19-2 is the registry number for 2-Bromo-3,4-dichloro-6-fluorobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3,4-dichloro-6-fluorobenzoic acid (CAS 2368910-19-2) is a chemical compound with the molecular formula C7H2BrCl2FO2 and a molecular weight of 287.89 g/mol. IUPAC name: 2-bromo-3,4-dichloro-6-fluorobenzoic acid. InChIKey: ZPDWVHNMIZYWBK-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2FO2 |
|---|---|
| Molecular weight | 287.89 g/mol |
| IUPAC name | 2-bromo-3,4-dichloro-6-fluorobenzoic acid |
| InChIKey | ZPDWVHNMIZYWBK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Br)C(=O)O)F |
Computed by PubChem (NCBI)