Products 2998554-42-8
CAS 2998554-42-8 is the registry number for 6-bromo-2,4-dichloro-3-fluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
6-bromo-2,4-dichloro-3-fluorobenzoic acid (CAS 2998554-42-8) is a chemical compound with the molecular formula C7H2BrCl2FO2 and a molecular weight of 287.89 g/mol. IUPAC name: 6-bromo-2,4-dichloro-3-fluorobenzoic acid. InChIKey: QOBKPVRFVXDUQH-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2FO2 |
|---|---|
| Molecular weight | 287.89 g/mol |
| IUPAC name | 6-bromo-2,4-dichloro-3-fluorobenzoic acid |
| InChIKey | QOBKPVRFVXDUQH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)C(=O)O)Cl)F)Cl |
Computed by PubChem (NCBI)