Products 2918847-21-7
CAS 2918847-21-7 is the registry number for 5-bromo-3,4-dichloro-2-fluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-3,4-dichloro-2-fluorobenzoic acid (CAS 2918847-21-7) is a chemical compound with the molecular formula C7H2BrCl2FO2 and a molecular weight of 287.89 g/mol. IUPAC name: 5-bromo-3,4-dichloro-2-fluorobenzoic acid. InChIKey: MWTKXWSQQMSAMX-UHFFFAOYSA-N.
| Molecular formula | C7H2BrCl2FO2 |
|---|---|
| Molecular weight | 287.89 g/mol |
| IUPAC name | 5-bromo-3,4-dichloro-2-fluorobenzoic acid |
| InChIKey | MWTKXWSQQMSAMX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)Cl)F)C(=O)O |
Computed by PubChem (NCBI)