CAS 2369068-42-6 appears in our catalog under these names: Thalidomide-O-C2-acid, 95(HPLC), Thalidomide-O-C2-acid, Thalidomide 4'–ether–alkylC2–acid, 3-{[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]oxy}propanoic acid, ≥95%(HPLC), ≥95%(HPLC), Thalidomide-O-C2-acid, 95.04%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 5mg, 50mg, 100 mg, 5 mg, 10 mg, 50 mg.
3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypropanoic acid (CAS 2369068-42-6) is a chemical compound with the molecular formula C16H14N2O7 and a molecular weight of 346.29 g/mol. IUPAC name: 3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypropanoic acid. InChIKey: JDORXWYUBMQFIZ-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O7 |
|---|---|
| Molecular weight | 346.29 g/mol |
| IUPAC name | 3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypropanoic acid |
| InChIKey | JDORXWYUBMQFIZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCCC(=O)O |
Computed by PubChem (NCBI)