CAS 2409918-51-8 is the registry number for 2-((2-(1-Methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetic acid (CAS 2409918-51-8) is a chemical compound with the molecular formula C16H14N2O7 and a molecular weight of 346.29 g/mol. IUPAC name: 2-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetic acid. InChIKey: UGOGPOIKGGGNBX-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O7 |
|---|---|
| Molecular weight | 346.29 g/mol |
| IUPAC name | 2-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetic acid |
| InChIKey | UGOGPOIKGGGNBX-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CCC(C1=O)N2C(=O)C3=C(C2=O)C(=CC=C3)OCC(=O)O |
Computed by PubChem (NCBI)